C27H25F5O — CID 58660714
8-fluoro-6-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene (PubChem CID 58660714) has the molecular formula C27H25F5O and a molecular weight of 460.49 g/mol. Its IUPAC name is 8-fluoro-6-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene.
| Compound Name | 8-fluoro-6-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 58660714 |
| Molecular Formula | C27H25F5O |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 8-fluoro-6-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c4c(c3)CCC(C(F)(F)F)O4)c(F)c2)cc1 |
| InChI | InChI=1S/C27H25F5O/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-22(23(28)15-19)21-14-20-11-13-25(27(30,31)32)33-26(20)24(29)16-21/h6-10,12,14-16,25H,2-5,11,13H2,1H3 |
| InChIKey | HLFQYXORHOLZAH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|