C7H12N4 — CID 58714711
(6S,7S)-6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (PubChem CID 58714711) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is (6S,7S)-6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
| Compound Name | (6S,7S)-6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 58714711 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | (6S,7S)-6,7-dimethyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
| SMILES | C[C@@H]1Cn2nnnc2C[C@@H]1C |
| InChI | InChI=1S/C7H12N4/c1-5-3-7-8-9-10-11(7)4-6(5)2/h5-6H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | CQLGOFBCHYBYIT-NTSWFWBYSA-N |
| XLogP | 0.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |