C16H14F12O4 — CID 58720461
2-[3-(1-ethoxyethoxy)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58720461) has the molecular formula C16H14F12O4 and a molecular weight of 498.26 g/mol. Its IUPAC name is 2-[3-(1-ethoxyethoxy)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-(1-ethoxyethoxy)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58720461 |
| Molecular Formula | C16H14F12O4 |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 2-[3-(1-ethoxyethoxy)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCOC(C)Oc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F12O4/c1-3-31-7(2)32-10-5-8(11(29,13(17,18)19)14(20,21)22)4-9(6-10)12(30,15(23,24)25)16(26,27)28/h4-7,29-30H,3H2,1-2H3 |
| InChIKey | AFBCEBMHYFBAIJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|