C20H29F3N3O5P — CID 58725013
[(2R)-2-amino-2-[5-[4-heptoxy-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 58725013) has the molecular formula C20H29F3N3O5P and a molecular weight of 479.44 g/mol. Its IUPAC name is [(2R)-2-amino-2-[5-[4-heptoxy-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-2-[5-[4-heptoxy-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58725013 |
| Molecular Formula | C20H29F3N3O5P |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [(2R)-2-amino-2-[5-[4-heptoxy-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | CCCCCCCOc1ccc(-c2cnc([C@@](C)(N)COP(=O)(O)O)[nH]2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H29F3N3O5P/c1-3-4-5-6-7-10-30-17-9-8-14(11-15(17)20(21,22)23)16-12-25-18(26-16)19(2,24)13-31-32(27,28)29/h8-9,11-12H,3-7,10,13,24H2,1-2H3,(H,25,26)(H2,27,28,29)/t19-/m0/s1 |
| InChIKey | GFIONEHVAIOHMS-IBGZPJMESA-N |
| XLogP | 4.73 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|