C20H30F3N2O6PS — CID 91313187
[(2S)-2-amino-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,4,2-oxathiazol-5-yl]propyl] dihydrogen phosphate (PubChem CID 91313187) has the molecular formula C20H30F3N2O6PS and a molecular weight of 514.50 g/mol. Its IUPAC name is [(2S)-2-amino-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,4,2-oxathiazol-5-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,4,2-oxathiazol-5-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91313187 |
| Molecular Formula | C20H30F3N2O6PS |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | [(2S)-2-amino-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,4,2-oxathiazol-5-yl]propyl] dihydrogen phosphate |
| SMILES | CCCCCCCCOc1ccc(C2=NOC([C@@](C)(N)COP(=O)(O)O)S2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H30F3N2O6PS/c1-3-4-5-6-7-8-11-29-16-10-9-14(12-15(16)20(21,22)23)17-25-31-18(33-17)19(2,24)13-30-32(26,27)28/h9-10,12,18H,3-8,11,13,24H2,1-2H3,(H2,26,27,28)/t18?,19-/m0/s1 |
| InChIKey | OQGVCKMVQDZOCZ-GGYWPGCISA-N |
| XLogP | 5.02 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|