C20H29F3N3O5PS — CID 143622422
[2-amino-2-[2-[4-octoxy-3-(trifluoromethyl)phenyl]-6H-1,3,4-thiadiazin-5-yl]ethyl] dihydrogen phosphate (PubChem CID 143622422) has the molecular formula C20H29F3N3O5PS and a molecular weight of 511.50 g/mol. Its IUPAC name is [2-amino-2-[2-[4-octoxy-3-(trifluoromethyl)phenyl]-6H-1,3,4-thiadiazin-5-yl]ethyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-[2-[4-octoxy-3-(trifluoromethyl)phenyl]-6H-1,3,4-thiadiazin-5-yl]ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 143622422 |
| Molecular Formula | C20H29F3N3O5PS |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | [2-amino-2-[2-[4-octoxy-3-(trifluoromethyl)phenyl]-6H-1,3,4-thiadiazin-5-yl]ethyl] dihydrogen phosphate |
| SMILES | CCCCCCCCOc1ccc(C2=NN=C(C(N)COP(=O)(O)O)CS2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H29F3N3O5PS/c1-2-3-4-5-6-7-10-30-18-9-8-14(11-15(18)20(21,22)23)19-26-25-17(13-33-19)16(24)12-31-32(27,28)29/h8-9,11,16H,2-7,10,12-13,24H2,1H3,(H2,27,28,29) |
| InChIKey | YFCFLZONXGDNQT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|