C10H5F15 — CID 58729237
4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)non-1-ene (PubChem CID 58729237) has the molecular formula C10H5F15 and a molecular weight of 410.12 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)non-1-ene.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)non-1-ene |
|---|---|
| PubChem CID | 58729237 |
| Molecular Formula | C10H5F15 |
| Molecular Weight | 410.12 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)non-1-ene |
| SMILES | C=CC(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H5F15/c1-2-3(7(17,18)19)5(13,14)8(20,21)10(24,25)9(22,23)6(15,16)4(11)12/h2-4H,1H2 |
| InChIKey | KKNHCBIOUCYEFA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.12 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|