C18H27N3O3 — CID 58756788
(4S)-4-(4-aminobutyl)-12-oxa-2,5-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,6-dione (PubChem CID 58756788) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (4S)-4-(4-aminobutyl)-12-oxa-2,5-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,6-dione.
| Compound Name | (4S)-4-(4-aminobutyl)-12-oxa-2,5-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,6-dione |
|---|---|
| PubChem CID | 58756788 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (4S)-4-(4-aminobutyl)-12-oxa-2,5-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,6-dione |
| SMILES | NCCCC[C@@H]1NC(=O)CCCCCOc2ccccc2NC1=O |
| InChI | InChI=1S/C18H27N3O3/c19-12-6-5-9-15-18(23)21-14-8-3-4-10-16(14)24-13-7-1-2-11-17(22)20-15/h3-4,8,10,15H,1-2,5-7,9,11-13,19H2,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | QSNNEZDJZZPQQU-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|