C29H32N2O5S — CID 58771515
1-O-[2-[4-[(E)-2-[5-[(Z)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]ethenyl]phenoxy]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 58771515) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is 1-O-[2-[4-[(E)-2-[5-[(Z)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]ethenyl]phenoxy]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-[4-[(E)-2-[5-[(Z)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]ethenyl]phenoxy]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58771515 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 1-O-[2-[4-[(E)-2-[5-[(Z)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]ethenyl]phenoxy]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(/C=C/c2ccc(OCCOC(=O)C(C)(C)CC(C)(CC)C(=O)OC)cc2)s1 |
| InChI | InChI=1S/C29H32N2O5S/c1-7-29(4,27(33)34-6)20-28(2,3)26(32)36-17-16-35-23-11-8-21(9-12-23)10-13-24-14-15-25(37-24)18-22(19-30)31-5/h8-15,18H,7,16-17,20H2,1-4,6H3/b13-10+,22-18- |
| InChIKey | ZJQBCVIVNWDUOA-UQFKYPQTSA-N |
| XLogP | 6.63 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|