C30H30FNO5P2 — CID 58774080
[fluoro(phosphanyl)phosphanyl] 2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetate (PubChem CID 58774080) has the molecular formula C30H30FNO5P2 and a molecular weight of 565.52 g/mol. Its IUPAC name is [fluoro(phosphanyl)phosphanyl] 2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetate.
| Compound Name | [fluoro(phosphanyl)phosphanyl] 2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetate |
|---|---|
| PubChem CID | 58774080 |
| Molecular Formula | C30H30FNO5P2 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | [fluoro(phosphanyl)phosphanyl] 2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetate |
| SMILES | COc1ccc(C(OCN(CC(=O)OP(F)P)c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H30FNO5P2/c1-34-27-17-13-24(14-18-27)30(23-9-5-3-6-10-23,25-15-19-28(35-2)20-16-25)36-22-32(21-29(33)37-39(31)38)26-11-7-4-8-12-26/h3-20H,21-22,38H2,1-2H3 |
| InChIKey | UFXQWUVDGAWNSH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|