C19H28O9S — CID 58783030
4-[7-(2-hydroxyethoxy)-5-(2-hydroxyethoxycarbonyl)-5-methyl-7-oxoheptan-3-yl]benzenesulfonic acid (PubChem CID 58783030) has the molecular formula C19H28O9S and a molecular weight of 432.49 g/mol. Its IUPAC name is 4-[7-(2-hydroxyethoxy)-5-(2-hydroxyethoxycarbonyl)-5-methyl-7-oxoheptan-3-yl]benzenesulfonic acid.
| Compound Name | 4-[7-(2-hydroxyethoxy)-5-(2-hydroxyethoxycarbonyl)-5-methyl-7-oxoheptan-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58783030 |
| Molecular Formula | C19H28O9S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-[7-(2-hydroxyethoxy)-5-(2-hydroxyethoxycarbonyl)-5-methyl-7-oxoheptan-3-yl]benzenesulfonic acid |
| SMILES | CCC(CC(C)(CC(=O)OCCO)C(=O)OCCO)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H28O9S/c1-3-14(15-4-6-16(7-5-15)29(24,25)26)12-19(2,18(23)28-11-9-21)13-17(22)27-10-8-20/h4-7,14,20-21H,3,8-13H2,1-2H3,(H,24,25,26) |
| InChIKey | AIOJPFXLKWZXJM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|