C21H25N3O3 — CID 58794934
9H-fluoren-9-ylmethyl N-(6-aminohexanoylamino)carbamate (PubChem CID 58794934) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(6-aminohexanoylamino)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(6-aminohexanoylamino)carbamate |
|---|---|
| PubChem CID | 58794934 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(6-aminohexanoylamino)carbamate |
| SMILES | NCCCCCC(=O)NNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H25N3O3/c22-13-7-1-2-12-20(25)23-24-21(26)27-14-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,19H,1-2,7,12-14,22H2,(H,23,25)(H,24,26) |
| InChIKey | DPHKCFUEGGQPPR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|