C45H24N12 — CID 58803367
2-[4,6-bis(3H-pyrrolo[3,2-f][4,7]phenanthrolin-2-yl)-1,3,5-triazin-2-yl]-3H-pyrrolo[3,2-f][4,7]phenanthroline (PubChem CID 58803367) has the molecular formula C45H24N12 and a molecular weight of 732.77 g/mol. Its IUPAC name is 2-[4,6-bis(3H-pyrrolo[3,2-f][4,7]phenanthrolin-2-yl)-1,3,5-triazin-2-yl]-3H-pyrrolo[3,2-f][4,7]phenanthroline.
| Compound Name | 2-[4,6-bis(3H-pyrrolo[3,2-f][4,7]phenanthrolin-2-yl)-1,3,5-triazin-2-yl]-3H-pyrrolo[3,2-f][4,7]phenanthroline |
|---|---|
| PubChem CID | 58803367 |
| Molecular Formula | C45H24N12 |
| Molecular Weight | 732.77 g/mol |
| Exact Mass | 732.22 |
| IUPAC Name | 2-[4,6-bis(3H-pyrrolo[3,2-f][4,7]phenanthrolin-2-yl)-1,3,5-triazin-2-yl]-3H-pyrrolo[3,2-f][4,7]phenanthroline |
| SMILES | c1cnc2c3c(c4ncccc4c2c1)N=C(c1nc(C2=Nc4c(c5ncccc5c5cccnc45)C2)nc(C2=Nc4c(c5ncccc5c5cccnc45)C2)n1)C3 |
| InChI | InChI=1S/C45H24N12/c1-7-22-25-10-4-16-49-37(25)40-28(34(22)46-13-1)19-31(52-40)43-55-44(32-20-29-35-23(8-2-14-47-35)26-11-5-17-50-38(26)41(29)53-32)57-45(56-43)33-21-30-36-24(9-3-15-48-36)27-12-6-18-51-39(27)42(30)54-33/h1-18H,19-21H2 |
| InChIKey | INRARXKVQJWUFI-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 153.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.77 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|