C16H19BN2O3 — CID 58804139
[4-[2-(1,3-dioxoisoindol-2-yl)ethylidene]piperidin-1-yl]-methylborinic acid (PubChem CID 58804139) has the molecular formula C16H19BN2O3 and a molecular weight of 298.15 g/mol. Its IUPAC name is [4-[2-(1,3-dioxoisoindol-2-yl)ethylidene]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[2-(1,3-dioxoisoindol-2-yl)ethylidene]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58804139 |
| Molecular Formula | C16H19BN2O3 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [4-[2-(1,3-dioxoisoindol-2-yl)ethylidene]piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(=CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C16H19BN2O3/c1-17(22)18-9-6-12(7-10-18)8-11-19-15(20)13-4-2-3-5-14(13)16(19)21/h2-5,8,22H,6-7,9-11H2,1H3 |
| InChIKey | MJYJREZJIMOBIV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|