About (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate
(5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate (PubChem CID 58813317) has the molecular formula C8H12O6S
and a molecular weight of 236.24 g/mol. Its IUPAC name is (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate.
Analyze (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate?
The IUPAC name of (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate (CID 58813317) is (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate.
What is the SMILES notation for (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate?
The canonical SMILES for (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate is CCC(=O)OC1OC(OC(=O)OC)CS1.
What is the InChIKey of (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate?
The InChIKey is PXKKLYYQWWDZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O6S/c1-3-5(9)12-8-14-6(4-15-8)13-7(10)11-2/h6,8H,3-4H2,1-2H3.
What are the key properties of (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate?
(5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate has a molecular weight of 236.24 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxycarbonyloxy-1,3-oxathiolan-2-yl) propanoate is sourced from PubChem (CID 58813317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).