C16H28BNO2 — CID 58836630
1-methyl-2-[(1R,2S,6R,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine (PubChem CID 58836630) has the molecular formula C16H28BNO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is 1-methyl-2-[(1R,2S,6R,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine.
| Compound Name | 1-methyl-2-[(1R,2S,6R,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine |
|---|---|
| PubChem CID | 58836630 |
| Molecular Formula | C16H28BNO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 1-methyl-2-[(1R,2S,6R,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine |
| SMILES | CN1CCCC1B1O[C@]2(C)C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C16H28BNO2/c1-14(2)11-9-12(14)16(4)15(3,10-11)19-17(20-16)13-7-6-8-18(13)5/h11-13H,6-10H2,1-5H3/t11-,12-,13?,15-,16+/m1/s1 |
| InChIKey | ULLNYISKCBEQNT-LVMBCBDASA-N |
| XLogP | 2.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|