C15H29BClNO2 — CID 138393824
(1R)-2-methyl-1-[(1S,2S,6R,8S)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride (PubChem CID 138393824) has the molecular formula C15H29BClNO2 and a molecular weight of 301.67 g/mol. Its IUPAC name is (1R)-2-methyl-1-[(1S,2S,6R,8S)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride.
| Compound Name | (1R)-2-methyl-1-[(1S,2S,6R,8S)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 138393824 |
| Molecular Formula | C15H29BClNO2 |
| Molecular Weight | 301.67 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (1R)-2-methyl-1-[(1S,2S,6R,8S)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride |
| SMILES | CC(C)[C@H](N)B1O[C@]2(C)C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1.Cl |
| InChI | InChI=1S/C15H28BNO2.ClH/c1-9(2)12(17)16-18-14(5)8-10-7-11(13(10,3)4)15(14,6)19-16;/h9-12H,7-8,17H2,1-6H3;1H/t10-,11-,12-,14+,15-;/m0./s1 |
| InChIKey | HOXLMVYTESWCRR-MESQRMADSA-N |
| XLogP | 3.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|