C21H32BNO2 — CID 142596624
2-phenyl-1-[(2S)-2,9,9-trimethyl-6-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 142596624) has the molecular formula C21H32BNO2 and a molecular weight of 341.30 g/mol. Its IUPAC name is 2-phenyl-1-[(2S)-2,9,9-trimethyl-6-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | 2-phenyl-1-[(2S)-2,9,9-trimethyl-6-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 142596624 |
| Molecular Formula | C21H32BNO2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 2-phenyl-1-[(2S)-2,9,9-trimethyl-6-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | CC(C)C12CC3CC(C3(C)C)[C@]1(C)OB(C(N)Cc1ccccc1)O2 |
| InChI | InChI=1S/C21H32BNO2/c1-14(2)21-13-16-12-17(19(16,3)4)20(21,5)24-22(25-21)18(23)11-15-9-7-6-8-10-15/h6-10,14,16-18H,11-13,23H2,1-5H3/t16?,17?,18?,20-,21?/m0/s1 |
| InChIKey | YZESFLABNNSQPF-WYGOJCFESA-N |
| XLogP | 3.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|