C27H42BNO4 — CID 158956715
(2S)-2-(3-hydroxy-1-adamantyl)-1-[(2R)-2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]propan-1-one (PubChem CID 158956715) has the molecular formula C27H42BNO4 and a molecular weight of 455.45 g/mol. Its IUPAC name is (2S)-2-(3-hydroxy-1-adamantyl)-1-[(2R)-2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | (2S)-2-(3-hydroxy-1-adamantyl)-1-[(2R)-2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 158956715 |
| Molecular Formula | C27H42BNO4 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.32 |
| IUPAC Name | (2S)-2-(3-hydroxy-1-adamantyl)-1-[(2R)-2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]propan-1-one |
| SMILES | C[C@H](C(=O)N1CCC[C@H]1B1O[C@@H]2CC3CC(C3(C)C)[C@]2(C)O1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C27H42BNO4/c1-16(26-11-17-8-18(12-26)14-27(31,13-17)15-26)23(30)29-7-5-6-22(29)28-32-21-10-19-9-20(24(19,2)3)25(21,4)33-28/h16-22,31H,5-15H2,1-4H3/t16-,17?,18?,19?,20?,21-,22+,25+,26?,27?/m1/s1 |
| InChIKey | BGAZBOXKAJFJAA-RMGPDAKJSA-N |
| XLogP | 4.21 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|