C8H11O4S- — CID 58860320
(2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 58860320) has the molecular formula C8H11O4S- and a molecular weight of 203.24 g/mol. Its IUPAC name is (2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | (2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 58860320 |
| Molecular Formula | C8H11O4S- |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | (2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | O=C1CC2CCC1(CS(=O)(=O)[O-])C2 |
| InChI | InChI=1S/C8H12O4S/c9-7-3-6-1-2-8(7,4-6)5-13(10,11)12/h6H,1-5H2,(H,10,11,12)/p-1 |
| InChIKey | ADRPPOAZEODZBP-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|