C11H17O4S- — CID 170545467
(4,7,7-trimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 170545467) has the molecular formula C11H17O4S- and a molecular weight of 245.32 g/mol. Its IUPAC name is (4,7,7-trimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | (4,7,7-trimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 170545467 |
| Molecular Formula | C11H17O4S- |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (4,7,7-trimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC12CCC(CS(=O)(=O)[O-])(C(=O)C1)C2(C)C |
| InChI | InChI=1S/C11H18O4S/c1-9(2)10(3)4-5-11(9,8(12)6-10)7-16(13,14)15/h4-7H2,1-3H3,(H,13,14,15)/p-1 |
| InChIKey | FEQBDWMJSSNPOJ-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|