C25H38N3O5+ — CID 58895946
trimethyl-[5-[2-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-oxamoylindol-1-yl]pentyl]azanium (PubChem CID 58895946) has the molecular formula C25H38N3O5+ and a molecular weight of 460.60 g/mol. Its IUPAC name is trimethyl-[5-[2-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-oxamoylindol-1-yl]pentyl]azanium.
| Compound Name | trimethyl-[5-[2-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-oxamoylindol-1-yl]pentyl]azanium |
|---|---|
| PubChem CID | 58895946 |
| Molecular Formula | C25H38N3O5+ |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | trimethyl-[5-[2-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-oxamoylindol-1-yl]pentyl]azanium |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)OC(C)(C)C)cccc2n1CCCCC[N+](C)(C)C |
| InChI | InChI=1S/C25H37N3O5/c1-17-21(23(30)24(26)31)22-18(27(17)14-9-8-10-15-28(5,6)7)12-11-13-19(22)32-16-20(29)33-25(2,3)4/h11-13H,8-10,14-16H2,1-7H3,(H-,26,31)/p+1 |
| InChIKey | YLZORTXKMSZQAI-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|