C44H44N4O10 — CID 58895966
tert-butyl 2-[1-[[2-[2-[(4-ethoxy-2-methyl-3-oxamoylindol-1-yl)methoxy]phenyl]phenoxy]methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate (PubChem CID 58895966) has the molecular formula C44H44N4O10 and a molecular weight of 788.85 g/mol. Its IUPAC name is tert-butyl 2-[1-[[2-[2-[(4-ethoxy-2-methyl-3-oxamoylindol-1-yl)methoxy]phenyl]phenoxy]methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate.
| Compound Name | tert-butyl 2-[1-[[2-[2-[(4-ethoxy-2-methyl-3-oxamoylindol-1-yl)methoxy]phenyl]phenoxy]methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 58895966 |
| Molecular Formula | C44H44N4O10 |
| Molecular Weight | 788.85 g/mol |
| Exact Mass | 788.31 |
| IUPAC Name | tert-butyl 2-[1-[[2-[2-[(4-ethoxy-2-methyl-3-oxamoylindol-1-yl)methoxy]phenyl]phenoxy]methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate |
| SMILES | CCOc1cccc2c1c(C(=O)C(N)=O)c(C)n2COc1ccccc1-c1ccccc1OCn1c(C)c(C(=O)C(N)=O)c2c(OCC(=O)OC(C)(C)C)cccc21 |
| InChI | InChI=1S/C44H44N4O10/c1-7-54-33-20-12-16-29-38(33)36(40(50)42(45)52)25(2)47(29)23-56-31-18-10-8-14-27(31)28-15-9-11-19-32(28)57-24-48-26(3)37(41(51)43(46)53)39-30(48)17-13-21-34(39)55-22-35(49)58-44(4,5)6/h8-21H,7,22-24H2,1-6H3,(H2,45,52)(H2,46,53) |
| InChIKey | BNVOMFGWSBXICD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.85 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|