C27H51N3O3S9 — CID 58900438
1,3,5-tris[3-[2-(2-methylsulfanylethylsulfanyl)ethylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 58900438) has the molecular formula C27H51N3O3S9 and a molecular weight of 754.33 g/mol. Its IUPAC name is 1,3,5-tris[3-[2-(2-methylsulfanylethylsulfanyl)ethylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[3-[2-(2-methylsulfanylethylsulfanyl)ethylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 58900438 |
| Molecular Formula | C27H51N3O3S9 |
| Molecular Weight | 754.33 g/mol |
| Exact Mass | 753.14 |
| IUPAC Name | 1,3,5-tris[3-[2-(2-methylsulfanylethylsulfanyl)ethylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CSCCSCCSCCCn1c(=O)n(CCCSCCSCCSC)c(=O)n(CCCSCCSCCSC)c1=O |
| InChI | InChI=1S/C27H51N3O3S9/c1-34-13-16-40-22-19-37-10-4-7-28-25(31)29(8-5-11-38-20-23-41-17-14-35-2)27(33)30(26(28)32)9-6-12-39-21-24-42-18-15-36-3/h4-24H2,1-3H3 |
| InChIKey | CSKSUSAIJANCKG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.33 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|