C27H20N3Pt- — CID 58947217
4-[3-[1-(2-benzylphenyl)imidazol-2-yl]benzene-4-id-1-yl]pyridine;platinum (PubChem CID 58947217) has the molecular formula C27H20N3Pt- and a molecular weight of 581.56 g/mol. Its IUPAC name is 4-[3-[1-(2-benzylphenyl)imidazol-2-yl]benzene-4-id-1-yl]pyridine;platinum.
| Compound Name | 4-[3-[1-(2-benzylphenyl)imidazol-2-yl]benzene-4-id-1-yl]pyridine;platinum |
|---|---|
| PubChem CID | 58947217 |
| Molecular Formula | C27H20N3Pt- |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 4-[3-[1-(2-benzylphenyl)imidazol-2-yl]benzene-4-id-1-yl]pyridine;platinum |
| SMILES | [Pt].[c-]1ccc(-c2ccncc2)cc1-c1nccn1-c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C27H20N3.Pt/c1-2-7-21(8-3-1)19-24-9-4-5-12-26(24)30-18-17-29-27(30)25-11-6-10-23(20-25)22-13-15-28-16-14-22;/h1-10,12-18,20H,19H2;/q-1; |
| InChIKey | AIQFFJNTHTVUDL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|