C10H11NO3S — CID 58962342
5-methoxy-1-methyl-2λ6,1-benzothiazine 2,2-dioxide (PubChem CID 58962342) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 5-methoxy-1-methyl-2λ6,1-benzothiazine 2,2-dioxide.
| Compound Name | 5-methoxy-1-methyl-2λ6,1-benzothiazine 2,2-dioxide |
|---|---|
| PubChem CID | 58962342 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 5-methoxy-1-methyl-2λ6,1-benzothiazine 2,2-dioxide |
| SMILES | COc1cccc2c1C=CS(=O)(=O)N2C |
| InChI | InChI=1S/C10H11NO3S/c1-11-9-4-3-5-10(14-2)8(9)6-7-15(11,12)13/h3-7H,1-2H3 |
| InChIKey | ABNYQUVLGFXNOW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |