C23H34F3N3O2Si — CID 58970347
N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-ethyl-N-[4-(trifluoromethoxy)phenyl]pyrimidin-2-amine (PubChem CID 58970347) has the molecular formula C23H34F3N3O2Si and a molecular weight of 469.62 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-ethyl-N-[4-(trifluoromethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-ethyl-N-[4-(trifluoromethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58970347 |
| Molecular Formula | C23H34F3N3O2Si |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-ethyl-N-[4-(trifluoromethoxy)phenyl]pyrimidin-2-amine |
| SMILES | CCc1cnc(N(CCCCO[Si](C)(C)C(C)(C)C)c2ccc(OC(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C23H34F3N3O2Si/c1-7-18-16-27-21(28-17-18)29(14-8-9-15-30-32(5,6)22(2,3)4)19-10-12-20(13-11-19)31-23(24,25)26/h10-13,16-17H,7-9,14-15H2,1-6H3 |
| InChIKey | QKGMBLUWMPYFFO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|