C19H34O5Si3 — CID 58975751
4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl 2-oxo-2-phenylacetate (PubChem CID 58975751) has the molecular formula C19H34O5Si3 and a molecular weight of 426.73 g/mol. Its IUPAC name is 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl 2-oxo-2-phenylacetate.
| Compound Name | 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 58975751 |
| Molecular Formula | C19H34O5Si3 |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl 2-oxo-2-phenylacetate |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCCOC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H34O5Si3/c1-25(2,3)23-27(6,7)24-26(4,5)16-12-11-15-22-19(21)18(20)17-13-9-8-10-14-17/h8-10,13-14H,11-12,15-16H2,1-7H3 |
| InChIKey | IDOSGLJBJPKLOO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|