C16H16IrN2 — CID 58986620
iridium;1,4,7-trimethyl-3-phenyl-2H-benzimidazol-2-ylium (PubChem CID 58986620) has the molecular formula C16H16IrN2 and a molecular weight of 428.54 g/mol. Its IUPAC name is iridium;1,4,7-trimethyl-3-phenyl-2H-benzimidazol-2-ylium.
| Compound Name | iridium;1,4,7-trimethyl-3-phenyl-2H-benzimidazol-2-ylium |
|---|---|
| PubChem CID | 58986620 |
| Molecular Formula | C16H16IrN2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | iridium;1,4,7-trimethyl-3-phenyl-2H-benzimidazol-2-ylium |
| SMILES | Cc1ccc(C)c2c1n(C)[cH+]n2-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C16H16N2.Ir/c1-12-9-10-13(2)16-15(12)17(3)11-18(16)14-7-5-4-6-8-14;/h4-7,9-11H,1-3H3; |
| InChIKey | WDXZEYHVPJPLCR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|