C10H6F8N2 — CID 59005767
1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole (PubChem CID 59005767) has the molecular formula C10H6F8N2 and a molecular weight of 306.16 g/mol. Its IUPAC name is 1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole.
| Compound Name | 1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole |
|---|---|
| PubChem CID | 59005767 |
| Molecular Formula | C10H6F8N2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole |
| SMILES | Cn1ccnc1C1=CC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H6F8N2/c1-20-3-2-19-6(20)5-4-7(11,12)9(15,16)10(17,18)8(5,13)14/h2-4H,1H3 |
| InChIKey | HODBNPQBAIYJNE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|