C27H36N2O8 — CID 59040171
[(3S,6S,7R,8R)-8-ethyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] (2E)-3,7-dimethylocta-2,6-dienoate (PubChem CID 59040171) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-8-ethyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] (2E)-3,7-dimethylocta-2,6-dienoate.
| Compound Name | [(3S,6S,7R,8R)-8-ethyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] (2E)-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 59040171 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | [(3S,6S,7R,8R)-8-ethyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] (2E)-3,7-dimethylocta-2,6-dienoate |
| SMILES | CC[C@@H]1C(=O)OC[C@H](NC(=O)c2nccc(C)c2O)C(=O)O[C@@H](C)[C@@H]1OC(=O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C27H36N2O8/c1-7-19-24(37-21(30)13-16(4)10-8-9-15(2)3)18(6)36-27(34)20(14-35-26(19)33)29-25(32)22-23(31)17(5)11-12-28-22/h9,11-13,18-20,24,31H,7-8,10,14H2,1-6H3,(H,29,32)/b16-13+/t18-,19-,20-,24-/m0/s1 |
| InChIKey | ACWAAHUXRXFSLT-NUXXPURVSA-N |
| XLogP | 3.31 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|