C22H23NO6 — CID 59052775
methyl (1S,2R,3R,4S,5R,6R)-3-formyl-2-hydroxy-2-methyl-5-nitro-4,6-diphenylcyclohexane-1-carboxylate (PubChem CID 59052775) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl (1S,2R,3R,4S,5R,6R)-3-formyl-2-hydroxy-2-methyl-5-nitro-4,6-diphenylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2R,3R,4S,5R,6R)-3-formyl-2-hydroxy-2-methyl-5-nitro-4,6-diphenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59052775 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl (1S,2R,3R,4S,5R,6R)-3-formyl-2-hydroxy-2-methyl-5-nitro-4,6-diphenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccccc2)[C@H]([N+](=O)[O-])[C@H](c2ccccc2)[C@@H](C=O)[C@@]1(C)O |
| InChI | InChI=1S/C22H23NO6/c1-22(26)16(13-24)17(14-9-5-3-6-10-14)20(23(27)28)18(19(22)21(25)29-2)15-11-7-4-8-12-15/h3-13,16-20,26H,1-2H3/t16-,17-,18+,19-,20-,22-/m1/s1 |
| InChIKey | QAHDBBGRPARLEW-WWFOSYLESA-N |
| XLogP | 2.57 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|