C13H15N2O3S- — CID 59058557
[2-cyano-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]ethenylidene]azanide (PubChem CID 59058557) has the molecular formula C13H15N2O3S- and a molecular weight of 279.34 g/mol. Its IUPAC name is [2-cyano-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]ethenylidene]azanide.
| Compound Name | [2-cyano-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]ethenylidene]azanide |
|---|---|
| PubChem CID | 59058557 |
| Molecular Formula | C13H15N2O3S- |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | [2-cyano-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]ethenylidene]azanide |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)C(=C=[N-])C#N)C(=O)C2 |
| InChI | InChI=1S/C13H15N2O3S/c1-12(2)9-3-4-13(12,11(16)5-9)8-19(17,18)10(6-14)7-15/h9H,3-5,8H2,1-2H3/q-1 |
| InChIKey | CXPBDOZOQIQZRP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|