C20H37AcNO2 — CID 59084183
actinium;(2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one (PubChem CID 59084183) has the molecular formula C20H37AcNO2 and a molecular weight of 554.55 g/mol. Its IUPAC name is actinium;(2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one.
| Compound Name | actinium;(2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one |
|---|---|
| PubChem CID | 59084183 |
| Molecular Formula | C20H37AcNO2 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | actinium;(2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one |
| SMILES | [2H]/C(=C\C[C@@H](C)C(O)[C@H]1C(=O)CCCCCCCCCCN1C)C([2H])([2H])[2H].[Ac] |
| InChI | InChI=1S/C20H37NO2.Ac/c1-4-5-14-17(2)20(23)19-18(22)15-12-10-8-6-7-9-11-13-16-21(19)3;/h4-5,17,19-20,23H,6-16H2,1-3H3;/b5-4+;/t17-,19-,20?;/m1./s1/i1D3,4D; |
| InChIKey | OMNJZQMSGRXAMW-HATNAKCRSA-N |
| XLogP | 4.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|