C20H37AcNO2 — CID 59084184
actinium;(2S)-2-[(Z,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methyl-azacyclotridecan-3-one (PubChem CID 59084184) has the molecular formula C20H37AcNO2 and a molecular weight of 550.52 g/mol. Its IUPAC name is actinium;(2S)-2-[(Z,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methyl-azacyclotridecan-3-one.
| Compound Name | actinium;(2S)-2-[(Z,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methyl-azacyclotridecan-3-one |
|---|---|
| PubChem CID | 59084184 |
| Molecular Formula | C20H37AcNO2 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | actinium;(2S)-2-[(Z,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methyl-azacyclotridecan-3-one |
| SMILES | C/C=C\C[C@@H](C)C(O)[C@H]1C(=O)CCCCCCCCCCN1C.[Ac] |
| InChI | InChI=1S/C20H37NO2.Ac/c1-4-5-14-17(2)20(23)19-18(22)15-12-10-8-6-7-9-11-13-16-21(19)3;/h4-5,17,19-20,23H,6-16H2,1-3H3;/b5-4-;/t17-,19-,20?;/m1./s1 |
| InChIKey | OMNJZQMSGRXAMW-KWMCPNSPSA-N |
| XLogP | 4.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|