C22H18ClN5O2S — CID 59092737
3-chloro-4-hydroxy-N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 59092737) has the molecular formula C22H18ClN5O2S and a molecular weight of 451.94 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59092737 |
| Molecular Formula | C22H18ClN5O2S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | Cn1cnnc1SCc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C22H18ClN5O2S/c1-28-13-25-27-22(28)31-12-16-7-6-15(17-4-2-3-5-18(16)17)11-24-26-21(30)14-8-9-20(29)19(23)10-14/h2-11,13,29H,12H2,1H3,(H,26,30)/b24-11+ |
| InChIKey | XSOODOSWDWRGTG-BHGWPJFGSA-N |
| XLogP | 4.38 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|