C24H25NO4 — CID 59095352
(2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2-methylbutanoate (PubChem CID 59095352) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2-methylbutanoate.
| Compound Name | (2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 59095352 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1c2ccccc2CC2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C24H25NO4/c1-3-15(2)24(28)29-21-18-12-8-7-11-17(18)13-19-20(21)23(27)25(22(19)26)14-16-9-5-4-6-10-16/h4-12,15,19-21H,3,13-14H2,1-2H3 |
| InChIKey | CYQRANVOVGAILZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|