C21H19AcOP — CID 59096295
actinium;3,7,8-trimethyl-5-phenylbenzo[b]phosphindol-2-ol (PubChem CID 59096295) has the molecular formula C21H19AcOP and a molecular weight of 545.36 g/mol. Its IUPAC name is actinium;3,7,8-trimethyl-5-phenylbenzo[b]phosphindol-2-ol.
| Compound Name | actinium;3,7,8-trimethyl-5-phenylbenzo[b]phosphindol-2-ol |
|---|---|
| PubChem CID | 59096295 |
| Molecular Formula | C21H19AcOP |
| Molecular Weight | 545.36 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | actinium;3,7,8-trimethyl-5-phenylbenzo[b]phosphindol-2-ol |
| SMILES | Cc1cc2c3cc(O)c(C)cc3p(-c3ccccc3)c2cc1C.[Ac] |
| InChI | InChI=1S/C21H19OP.Ac/c1-13-9-17-18-12-19(22)15(3)11-21(18)23(20(17)10-14(13)2)16-7-5-4-6-8-16;/h4-12,22H,1-3H3; |
| InChIKey | BMQZGVSXDLEFPX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.36 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |