C20H17Ac2O2P — CID 59096280
actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol (PubChem CID 59096280) has the molecular formula C20H17Ac2O2P and a molecular weight of 774.33 g/mol. Its IUPAC name is actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol.
| Compound Name | actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol |
|---|---|
| PubChem CID | 59096280 |
| Molecular Formula | C20H17Ac2O2P |
| Molecular Weight | 774.33 g/mol |
| Exact Mass | 774.15 |
| IUPAC Name | actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol |
| SMILES | Cc1cc2c(cc1O)c1cc(O)c(C)cc1p2-c1ccccc1.[Ac].[Ac] |
| InChI | InChI=1S/C20H17O2P.2Ac/c1-12-8-19-15(10-17(12)21)16-11-18(22)13(2)9-20(16)23(19)14-6-4-3-5-7-14;;/h3-11,21-22H,1-2H3;; |
| InChIKey | DPXCUOUMFOIFEF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |