About actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol
actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol (PubChem CID 59096280) has the molecular formula C20H17Ac2O2P
and a molecular weight of 774.33 g/mol. Its IUPAC name is actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol.
Molecular Properties
| Compound Name | actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol |
| PubChem CID | 59096280 |
| Molecular Formula | C20H17Ac2O2P |
| Molecular Weight | 774.33 g/mol |
| Exact Mass | 774.15 |
| IUPAC Name | actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol |
| SMILES | Cc1cc2c(cc1O)c1cc(O)c(C)cc1p2-c1ccccc1.[Ac].[Ac] |
| InChI | InChI=1S/C20H17O2P.2Ac/c1-12-8-19-15(10-17(12)21)16-11-18(22)13(2)9-20(16)23(19)14-6-4-3-5-7-14;;/h3-11,21-22H,1-2H3;; |
| InChIKey | DPXCUOUMFOIFEF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 774.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol?
The IUPAC name of actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol (CID 59096280) is actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol.
What is the SMILES notation for actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol?
The canonical SMILES for actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol is Cc1cc2c(cc1O)c1cc(O)c(C)cc1p2-c1ccccc1.[Ac].[Ac].
What is the InChIKey of actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol?
The InChIKey is DPXCUOUMFOIFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17O2P.2Ac/c1-12-8-19-15(10-17(12)21)16-11-18(22)13(2)9-20(16)23(19)14-6-4-3-5-7-14;;/h3-11,21-22H,1-2H3;;.
What are the key properties of actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol?
actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol has a molecular weight of 774.33 g/mol, XLogP of 6.00, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;3,7-dimethyl-5-phenylbenzo[b]phosphindole-2,8-diol is sourced from PubChem (CID 59096280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).