C32H35F5O4S2 — CID 59109853
(3S,4S)-3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromen-7-ol (PubChem CID 59109853) has the molecular formula C32H35F5O4S2 and a molecular weight of 642.75 g/mol. Its IUPAC name is (3S,4S)-3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromen-7-ol.
| Compound Name | (3S,4S)-3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 59109853 |
| Molecular Formula | C32H35F5O4S2 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | (3S,4S)-3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromen-7-ol |
| SMILES | C[C@]1(c2ccc(O)cc2)CSc2cc(O)ccc2[C@H]1CCCOc1ccc(OCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H35F5O4S2/c1-30(22-5-7-23(38)8-6-22)21-43-29-20-24(39)9-14-27(29)28(30)4-2-16-40-25-10-12-26(13-11-25)41-17-19-42-18-3-15-31(33,34)32(35,36)37/h5-14,20,28,38-39H,2-4,15-19,21H2,1H3/t28-,30-/m1/s1 |
| InChIKey | VFGDQSMPGJZIOD-PQHLKRTFSA-N |
| XLogP | 9.19 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|