C14H29NOSSi — CID 59197567
(S)-N,2-dimethyl-N-[(3S)-4-methyl-1-trimethylsilylpent-1-yn-3-yl]propane-2-sulfinamide (PubChem CID 59197567) has the molecular formula C14H29NOSSi and a molecular weight of 287.55 g/mol. Its IUPAC name is (S)-N,2-dimethyl-N-[(3S)-4-methyl-1-trimethylsilylpent-1-yn-3-yl]propane-2-sulfinamide.
| Compound Name | (S)-N,2-dimethyl-N-[(3S)-4-methyl-1-trimethylsilylpent-1-yn-3-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 59197567 |
| Molecular Formula | C14H29NOSSi |
| Molecular Weight | 287.55 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (S)-N,2-dimethyl-N-[(3S)-4-methyl-1-trimethylsilylpent-1-yn-3-yl]propane-2-sulfinamide |
| SMILES | CC(C)[C@@H](C#C[Si](C)(C)C)N(C)[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H29NOSSi/c1-12(2)13(10-11-18(7,8)9)15(6)17(16)14(3,4)5/h12-13H,1-9H3/t13-,17+/m1/s1 |
| InChIKey | ROYSZTYRWUZPEA-DYVFJYSZSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|