C11H14Cl3NO6 — CID 59202693
[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate (PubChem CID 59202693) has the molecular formula C11H14Cl3NO6 and a molecular weight of 362.59 g/mol. Its IUPAC name is [(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 59202693 |
| Molecular Formula | C11H14Cl3NO6 |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | [(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(C)(C)[C@H](OC)C2OC(=O)OC12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl3NO6/c1-10(2)6(17-3)4-5(19-9(16)18-4)7(21-10)20-8(15)11(12,13)14/h4-7,15H,1-3H3/b15-8+/t4?,5?,6-,7?/m1/s1 |
| InChIKey | FWPYNYDRGPZEKJ-ZBPPXDDTSA-N |
| XLogP | 2.40 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|