C9H12Cl3FINO4 — CID 145027484
[3-fluoro-5-(iodooxymethyl)-4-methoxy-3-methyloxolan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 145027484) has the molecular formula C9H12Cl3FINO4 and a molecular weight of 450.46 g/mol. Its IUPAC name is [3-fluoro-5-(iodooxymethyl)-4-methoxy-3-methyloxolan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [3-fluoro-5-(iodooxymethyl)-4-methoxy-3-methyloxolan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 145027484 |
| Molecular Formula | C9H12Cl3FINO4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 448.89 |
| IUPAC Name | [3-fluoro-5-(iodooxymethyl)-4-methoxy-3-methyloxolan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(COI)C(OC)C1(C)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3FINO4/c1-8(13)5(16-2)4(3-17-14)18-7(8)19-6(15)9(10,11)12/h4-5,7,15H,3H2,1-2H3/b15-6+ |
| InChIKey | MNMXYJIUKKEMSP-GIDUJCDVSA-N |
| XLogP | 3.19 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|