C10H10Cl3F2N7O4 — CID 139575448
[(2R,3R)-5-azido-2-(azidomethyl)-4,4-difluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 139575448) has the molecular formula C10H10Cl3F2N7O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(2R,3R)-5-azido-2-(azidomethyl)-4,4-difluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R)-5-azido-2-(azidomethyl)-4,4-difluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 139575448 |
| Molecular Formula | C10H10Cl3F2N7O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | [(2R,3R)-5-azido-2-(azidomethyl)-4,4-difluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/OC1O[C@H](CN=[N+]=[N-])[C@@H](OC(C)=O)C(F)(F)C1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3F2N7O4/c1-3(23)24-6-4(2-19-21-17)25-7(26-8(16)10(11,12)13)5(20-22-18)9(6,14)15/h4-7,16H,2H2,1H3/b16-8+/t4-,5?,6-,7?/m1/s1 |
| InChIKey | HJTNCVKRVGEPNL-RBPGRFJJSA-N |
| XLogP | 3.63 |
| TPSA | 166.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|