C21H19N5 — CID 59214596
2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-4,5,6,7-tetrahydroindole (PubChem CID 59214596) has the molecular formula C21H19N5 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-4,5,6,7-tetrahydroindole.
| Compound Name | 2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 59214596 |
| Molecular Formula | C21H19N5 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-4,5,6,7-tetrahydroindole |
| SMILES | c1ccc(-c2cc3c(n2-c2cccc(-c4nn[nH]n4)c2)CCCC3)cc1 |
| InChI | InChI=1S/C21H19N5/c1-2-7-15(8-3-1)20-14-16-9-4-5-12-19(16)26(20)18-11-6-10-17(13-18)21-22-24-25-23-21/h1-3,6-8,10-11,13-14H,4-5,9,12H2,(H,22,23,24,25) |
| InChIKey | CSBOROXJVMJEAD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|