About isocyanobenzene;tungsten
isocyanobenzene;tungsten (PubChem CID 59216570) has the molecular formula C7H4NW-
and a molecular weight of 285.96 g/mol. Its IUPAC name is isocyanobenzene;tungsten.
Molecular Properties
| Compound Name | isocyanobenzene;tungsten |
| PubChem CID | 59216570 |
| Molecular Formula | C7H4NW- |
| Molecular Weight | 285.96 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | isocyanobenzene;tungsten |
| SMILES | [C-]#[N+]c1[c-]cccc1.[W] |
| InChI | InChI=1S/C7H4N.W/c1-8-7-5-3-2-4-6-7;/h2-5H;/q-1; |
| InChIKey | JOFZNINTEOJJFV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.96 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze isocyanobenzene;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanobenzene;tungsten?
The IUPAC name of isocyanobenzene;tungsten (CID 59216570) is isocyanobenzene;tungsten.
What is the SMILES notation for isocyanobenzene;tungsten?
The canonical SMILES for isocyanobenzene;tungsten is [C-]#[N+]c1[c-]cccc1.[W].
What is the InChIKey of isocyanobenzene;tungsten?
The InChIKey is JOFZNINTEOJJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N.W/c1-8-7-5-3-2-4-6-7;/h2-5H;/q-1;.
What are the key properties of isocyanobenzene;tungsten?
isocyanobenzene;tungsten has a molecular weight of 285.96 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanobenzene;tungsten is sourced from PubChem (CID 59216570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).