C15H22N3O5P — CID 59283923
3-[(2R,3R,5R)-5-(3,5-dimethyl-2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl]oxyphosphanyloxypropanenitrile (PubChem CID 59283923) has the molecular formula C15H22N3O5P and a molecular weight of 355.33 g/mol. Its IUPAC name is 3-[(2R,3R,5R)-5-(3,5-dimethyl-2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl]oxyphosphanyloxypropanenitrile.
| Compound Name | 3-[(2R,3R,5R)-5-(3,5-dimethyl-2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl]oxyphosphanyloxypropanenitrile |
|---|---|
| PubChem CID | 59283923 |
| Molecular Formula | C15H22N3O5P |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-[(2R,3R,5R)-5-(3,5-dimethyl-2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl]oxyphosphanyloxypropanenitrile |
| SMILES | CC[C@H]1O[C@@H](n2cc(C)c(=O)n(C)c2=O)C[C@H]1OPOCCC#N |
| InChI | InChI=1S/C15H22N3O5P/c1-4-11-12(23-24-21-7-5-6-16)8-13(22-11)18-9-10(2)14(19)17(3)15(18)20/h9,11-13,24H,4-5,7-8H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | HJFOGTFAMINYCU-JHJVBQTASA-N |
| XLogP | 1.38 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|