C18H27N3O5P2 — CID 91218714
CID 91218714 (PubChem CID 91218714) has the molecular formula C18H27N3O5P2 and a molecular weight of 427.38 g/mol.
| Compound Name | CID 91218714 |
|---|---|
| PubChem CID | 91218714 |
| Molecular Formula | C18H27N3O5P2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | — |
| SMILES | C/C=P(\C)=C\P(OCCC#N)OC1CC(n2ccc(=O)n(C)c2=O)OC1CC |
| InChI | InChI=1S/C18H27N3O5P2/c1-5-14-15(26-28(13-27(4)6-2)24-11-7-9-19)12-17(25-14)21-10-8-16(22)20(3)18(21)23/h6,8,10,13-15,17H,5,7,11-12H2,1-4H3 |
| InChIKey | NZBPDMSUNNYANF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|