C25H30ClN5O3 — CID 59322575
(E)-N-[4-[[(1S)-1-(4-chlorophenyl)-2-methoxyethyl]amino]-7-ethoxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 59322575) has the molecular formula C25H30ClN5O3 and a molecular weight of 484.00 g/mol. Its IUPAC name is (E)-N-[4-[[(1S)-1-(4-chlorophenyl)-2-methoxyethyl]amino]-7-ethoxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[[(1S)-1-(4-chlorophenyl)-2-methoxyethyl]amino]-7-ethoxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 59322575 |
| Molecular Formula | C25H30ClN5O3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (E)-N-[4-[[(1S)-1-(4-chlorophenyl)-2-methoxyethyl]amino]-7-ethoxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCOc1cc2ncnc(N[C@H](COC)c3ccc(Cl)cc3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C25H30ClN5O3/c1-5-34-23-14-20-19(13-21(23)29-24(32)7-6-12-31(2)3)25(28-16-27-20)30-22(15-33-4)17-8-10-18(26)11-9-17/h6-11,13-14,16,22H,5,12,15H2,1-4H3,(H,29,32)(H,27,28,30)/b7-6+/t22-/m1/s1 |
| InChIKey | PCEHPQJFQIHBCC-XYXUZSOXSA-N |
| XLogP | 4.54 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|