C26H33ClN6O4S — CID 118900270
(E)-N-[4-[3-chloro-4-(2-methylsulfinylethylamino)anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 118900270) has the molecular formula C26H33ClN6O4S and a molecular weight of 561.11 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-(2-methylsulfinylethylamino)anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-(2-methylsulfinylethylamino)anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 118900270 |
| Molecular Formula | C26H33ClN6O4S |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(2-methylsulfinylethylamino)anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(NCCS(C)=O)c(Cl)c3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C26H33ClN6O4S/c1-33(2)10-5-6-25(34)32-23-15-19-22(16-24(23)37-12-11-36-3)29-17-30-26(19)31-18-7-8-21(20(27)14-18)28-9-13-38(4)35/h5-8,14-17,28H,9-13H2,1-4H3,(H,32,34)(H,29,30,31)/b6-5+ |
| InChIKey | YQDUPIDZSOMOLN-AATRIKPKSA-N |
| XLogP | 3.90 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|